About 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one
1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one (PubChem CID 22728372) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one |
| PubChem CID | 22728372 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one |
| SMILES | CCN1CCCC1=O.O=C1CCCN1CCO |
| InChI | InChI=1S/C6H11NO2.C6H11NO/c8-5-4-7-3-1-2-6(7)9;1-2-7-5-3-4-6(7)8/h8H,1-5H2;2-5H2,1H3 |
| InChIKey | IEBFTRNJSLCXFF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one?
The IUPAC name of 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one (CID 22728372) is 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one.
What is the SMILES notation for 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one?
The canonical SMILES for 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one is CCN1CCCC1=O.O=C1CCCN1CCO.
What is the InChIKey of 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one?
The InChIKey is IEBFTRNJSLCXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C6H11NO/c8-5-4-7-3-1-2-6(7)9;1-2-7-5-3-4-6(7)8/h8H,1-5H2;2-5H2,1H3.
What are the key properties of 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one?
1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one has a molecular weight of 242.32 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrolidin-2-one;1-(2-hydroxyethyl)pyrrolidin-2-one is sourced from PubChem (CID 22728372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).