About 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione
5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione (PubChem CID 22728397) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione |
| PubChem CID | 22728397 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione |
| SMILES | CC(C)CC(=O)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C13H20O3/c1-8(2)5-9(14)12-10(15)6-13(3,4)7-11(12)16/h8,12H,5-7H2,1-4H3 |
| InChIKey | HNPWTDUZIXAJSA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione?
The IUPAC name of 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione (CID 22728397) is 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione.
What is the SMILES notation for 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione?
The canonical SMILES for 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione is CC(C)CC(=O)C1C(=O)CC(C)(C)CC1=O.
What is the InChIKey of 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione?
The InChIKey is HNPWTDUZIXAJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-8(2)5-9(14)12-10(15)6-13(3,4)7-11(12)16/h8,12H,5-7H2,1-4H3.
What are the key properties of 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione?
5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione has a molecular weight of 224.30 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione is sourced from PubChem (CID 22728397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).