C41H19BF20OS2 — CID 22728564
10-methylthianthren-10-ium 5-oxide;tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]boranuide (PubChem CID 22728564) has the molecular formula C41H19BF20OS2 and a molecular weight of 982.51 g/mol. Its IUPAC name is 10-methylthianthren-10-ium 5-oxide;tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]boranuide.
| Compound Name | 10-methylthianthren-10-ium 5-oxide;tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]boranuide |
|---|---|
| PubChem CID | 22728564 |
| Molecular Formula | C41H19BF20OS2 |
| Molecular Weight | 982.51 g/mol |
| Exact Mass | 982.07 |
| IUPAC Name | 10-methylthianthren-10-ium 5-oxide;tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]boranuide |
| SMILES | C[S+]1c2ccccc2S(=O)c2ccccc21.Fc1c(F)c(F)c(C[B-](Cc2c(F)c(F)c(F)c(F)c2F)(Cc2c(F)c(F)c(F)c(F)c2F)Cc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C28H8BF20.C13H11OS2/c30-9-5(10(31)18(39)25(46)17(9)38)1-29(2-6-11(32)19(40)26(47)20(41)12(6)33,3-7-13(34)21(42)27(48)22(43)14(7)35)4-8-15(36)23(44)28(49)24(45)16(8)37;1-15-10-6-2-4-8-12(10)16(14)13-9-5-3-7-11(13)15/h1-4H2;2-9H,1H3/q-1;+1 |
| InChIKey | IPTGAFKYNMKSIV-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.51 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|