C14H17NO2 — CID 2272862
(2E,4E,6E)-7-(dimethylamino)-1-(5-methylfuran-2-yl)hepta-2,4,6-trien-1-one (PubChem CID 2272862) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is (2E,4E,6E)-7-(dimethylamino)-1-(5-methylfuran-2-yl)hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6E)-7-(dimethylamino)-1-(5-methylfuran-2-yl)hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 2272862 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2E,4E,6E)-7-(dimethylamino)-1-(5-methylfuran-2-yl)hepta-2,4,6-trien-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/C=C/C=C/N(C)C)o1 |
| InChI | InChI=1S/C14H17NO2/c1-12-9-10-14(17-12)13(16)8-6-4-5-7-11-15(2)3/h4-11H,1-3H3/b5-4+,8-6+,11-7+ |
| InChIKey | AMADBTKMDWTQFY-XQKRVCAYSA-N |
| XLogP | 2.96 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|