About 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one
3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one (PubChem CID 22728845) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one.
Analyze 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one?
The IUPAC name of 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one (CID 22728845) is 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one.
What is the SMILES notation for 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one?
The canonical SMILES for 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one is CC1CCC2=C(C1)OC(=O)C2C.
What is the InChIKey of 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one?
The InChIKey is APRDSJRFFKMSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-6-3-4-8-7(2)10(11)12-9(8)5-6/h6-7H,3-5H2,1-2H3.
What are the key properties of 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one?
3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one has a molecular weight of 166.22 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-4,5,6,7-tetrahydro-3H-1-benzofuran-2-one is sourced from PubChem (CID 22728845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).