C20H22F3N5O2 — CID 22729629
N-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-4-(trifluoromethoxy)benzamide (PubChem CID 22729629) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is N-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 22729629 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-4-(trifluoromethoxy)benzamide |
| SMILES | Cc1nc(N)c2ncn(CCCCNC(=O)c3ccc(OC(F)(F)F)cc3)c2c1C |
| InChI | InChI=1S/C20H22F3N5O2/c1-12-13(2)27-18(24)16-17(12)28(11-26-16)10-4-3-9-25-19(29)14-5-7-15(8-6-14)30-20(21,22)23/h5-8,11H,3-4,9-10H2,1-2H3,(H2,24,27)(H,25,29) |
| InChIKey | FOVVSMWGYZNROA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|