C19H24N6O3S — CID 22729700
1-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-3-(benzenesulfonyl)urea (PubChem CID 22729700) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-3-(benzenesulfonyl)urea.
| Compound Name | 1-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-3-(benzenesulfonyl)urea |
|---|---|
| PubChem CID | 22729700 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butyl]-3-(benzenesulfonyl)urea |
| SMILES | Cc1nc(N)c2ncn(CCCCNC(=O)NS(=O)(=O)c3ccccc3)c2c1C |
| InChI | InChI=1S/C19H24N6O3S/c1-13-14(2)23-18(20)16-17(13)25(12-22-16)11-7-6-10-21-19(26)24-29(27,28)15-8-4-3-5-9-15/h3-5,8-9,12H,6-7,10-11H2,1-2H3,(H2,20,23)(H2,21,24,26) |
| InChIKey | WVRFBYZNAPIVHB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|