C19H30N6O — CID 22729724
1-[3-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)propyl]-3-cyclohexylurea (PubChem CID 22729724) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-[3-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)propyl]-3-cyclohexylurea.
| Compound Name | 1-[3-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)propyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 22729724 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-[3-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)propyl]-3-cyclohexylurea |
| SMILES | Cc1nc(N)c2nc(C)n(CCCNC(=O)NC3CCCCC3)c2c1C |
| InChI | InChI=1S/C19H30N6O/c1-12-13(2)22-18(20)16-17(12)25(14(3)23-16)11-7-10-21-19(26)24-15-8-5-4-6-9-15/h15H,4-11H2,1-3H3,(H2,20,22)(H2,21,24,26) |
| InChIKey | QMTUXOJSINPYPW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|