C22H27F3N6O2 — CID 22729795
1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 22729795) has the molecular formula C22H27F3N6O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is 1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 22729795 |
| Molecular Formula | C22H27F3N6O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CCOCc1nc2c(N)nc(C)c(C)c2n1CCCNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F3N6O2/c1-4-33-12-17-30-18-19(13(2)14(3)28-20(18)26)31(17)11-5-10-27-21(32)29-16-8-6-15(7-9-16)22(23,24)25/h6-9H,4-5,10-12H2,1-3H3,(H2,26,28)(H2,27,29,32) |
| InChIKey | GYPABZOHUHATSZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|