About 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole
2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole (PubChem CID 22731087) has the molecular formula C12H13BrN2OS
and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole |
| PubChem CID | 22731087 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole |
| SMILES | CC(C)(C)c1cnc(/C=C/c2cnc(Br)s2)o1 |
| InChI | InChI=1S/C12H13BrN2OS/c1-12(2,3)9-7-14-10(16-9)5-4-8-6-15-11(13)17-8/h4-7H,1-3H3/b5-4+ |
| InChIKey | XAEQSTACKFXNKH-SNAWJCMRSA-N |
| XLogP | 4.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole?
The IUPAC name of 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole (CID 22731087) is 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole.
What is the SMILES notation for 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole?
The canonical SMILES for 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole is CC(C)(C)c1cnc(/C=C/c2cnc(Br)s2)o1.
What is the InChIKey of 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole?
The InChIKey is XAEQSTACKFXNKH-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H13BrN2OS/c1-12(2,3)9-7-14-10(16-9)5-4-8-6-15-11(13)17-8/h4-7H,1-3H3/b5-4+.
What are the key properties of 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole?
2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole has a molecular weight of 313.22 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(2-bromo-1,3-thiazol-5-yl)ethenyl]-5-tert-butyl-1,3-oxazole is sourced from PubChem (CID 22731087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).