C28H32O3 — CID 22731333
(2E,4E)-5-[2-[7-(2,6-dimethylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 22731333) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is (2E,4E)-5-[2-[7-(2,6-dimethylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[2-[7-(2,6-dimethylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 22731333 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2E,4E)-5-[2-[7-(2,6-dimethylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/C1CC1(C)c1cc(-c2c(C)cccc2C)c2c(c1)C(C)(C)CO2)=C\C(=O)O |
| InChI | InChI=1S/C28H32O3/c1-17(12-24(29)30)10-11-20-15-28(20,6)21-13-22(25-18(2)8-7-9-19(25)3)26-23(14-21)27(4,5)16-31-26/h7-14,20H,15-16H2,1-6H3,(H,29,30)/b11-10+,17-12+ |
| InChIKey | UKIIHCUPCZFIME-SXSSDGSKSA-N |
| XLogP | 6.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|