About hexafluorozirconium(2-);hydron
hexafluorozirconium(2-);hydron (PubChem CID 22731701) has the molecular formula H2F6Zr
and a molecular weight of 207.23 g/mol. Its IUPAC name is hexafluorozirconium(2-);hydron.
Molecular Properties
| Compound Name | hexafluorozirconium(2-);hydron |
| PubChem CID | 22731701 |
| Molecular Formula | H2F6Zr |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 205.91 |
| IUPAC Name | hexafluorozirconium(2-);hydron |
| SMILES | F[Zr-2](F)(F)(F)(F)F.[H+].[H+] |
| InChI | InChI=1S/6FH.Zr/h6*1H;/q;;;;;;+4/p-4 |
| InChIKey | DXIGZHYPWYIZLM-UHFFFAOYSA-J |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hexafluorozirconium(2-);hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluorozirconium(2-);hydron?
The IUPAC name of hexafluorozirconium(2-);hydron (CID 22731701) is hexafluorozirconium(2-);hydron.
What is the SMILES notation for hexafluorozirconium(2-);hydron?
The canonical SMILES for hexafluorozirconium(2-);hydron is F[Zr-2](F)(F)(F)(F)F.[H+].[H+].
What is the InChIKey of hexafluorozirconium(2-);hydron?
The InChIKey is DXIGZHYPWYIZLM-UHFFFAOYSA-J. The full InChI is InChI=1S/6FH.Zr/h6*1H;/q;;;;;;+4/p-4.
What are the key properties of hexafluorozirconium(2-);hydron?
hexafluorozirconium(2-);hydron has a molecular weight of 207.23 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluorozirconium(2-);hydron is sourced from PubChem (CID 22731701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).