About N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide
N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide (PubChem CID 22732253) has the molecular formula C23H20N4O3
and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide.
Molecular Properties
| Compound Name | N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide |
| PubChem CID | 22732253 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide |
| SMILES | COc1cc2ncnc(Nc3cccc(NC(=O)c4ccccc4)c3)c2cc1OC |
| InChI | InChI=1S/C23H20N4O3/c1-29-20-12-18-19(13-21(20)30-2)24-14-25-22(18)26-16-9-6-10-17(11-16)27-23(28)15-7-4-3-5-8-15/h3-14H,1-2H3,(H,27,28)(H,24,25,26) |
| InChIKey | BLQGAUTUIVRLHZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide?
The IUPAC name of N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide (CID 22732253) is N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide.
What is the SMILES notation for N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide?
The canonical SMILES for N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide is COc1cc2ncnc(Nc3cccc(NC(=O)c4ccccc4)c3)c2cc1OC.
What is the InChIKey of N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide?
The InChIKey is BLQGAUTUIVRLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3/c1-29-20-12-18-19(13-21(20)30-2)24-14-25-22(18)26-16-9-6-10-17(11-16)27-23(28)15-7-4-3-5-8-15/h3-14H,1-2H3,(H,27,28)(H,24,25,26).
What are the key properties of N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide?
N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide has a molecular weight of 400.44 g/mol, XLogP of 4.64, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide is sourced from PubChem (CID 22732253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).