C22H10F8N4O — CID 22732484
N-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 22732484) has the molecular formula C22H10F8N4O and a molecular weight of 498.33 g/mol. Its IUPAC name is N-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22732484 |
| Molecular Formula | C22H10F8N4O |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | N-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Fc1c(F)c(F)c(Oc2cccc(Nc3cc(C(F)(F)F)nc(-c4cccnc4)n3)c2)c(F)c1F |
| InChI | InChI=1S/C22H10F8N4O/c23-15-16(24)18(26)20(19(27)17(15)25)35-12-5-1-4-11(7-12)32-14-8-13(22(28,29)30)33-21(34-14)10-3-2-6-31-9-10/h1-9H,(H,32,33,34) |
| InChIKey | FEAGOFUJSOVSDS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|