About (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol
(2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol (PubChem CID 22733405) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol.
Molecular Properties
| Compound Name | (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol |
| PubChem CID | 22733405 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol |
| SMILES | CCCCCC(/C=C1\Nc2ccc(O)cc2O1)CCCCC |
| InChI | InChI=1S/C19H29NO2/c1-3-5-7-9-15(10-8-6-4-2)13-19-20-17-12-11-16(21)14-18(17)22-19/h11-15,20-21H,3-10H2,1-2H3/b19-13+ |
| InChIKey | DRYGAOHNJMHACZ-CPNJWEJPSA-N |
| XLogP | 5.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol?
The IUPAC name of (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol (CID 22733405) is (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol.
What is the SMILES notation for (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol?
The canonical SMILES for (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol is CCCCCC(/C=C1\Nc2ccc(O)cc2O1)CCCCC.
What is the InChIKey of (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol?
The InChIKey is DRYGAOHNJMHACZ-CPNJWEJPSA-N. The full InChI is InChI=1S/C19H29NO2/c1-3-5-7-9-15(10-8-6-4-2)13-19-20-17-12-11-16(21)14-18(17)22-19/h11-15,20-21H,3-10H2,1-2H3/b19-13+.
What are the key properties of (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol?
(2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol has a molecular weight of 303.45 g/mol, XLogP of 5.81, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2-pentylheptylidene)-3H-1,3-benzoxazol-6-ol is sourced from PubChem (CID 22733405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).