About 3,5-dibromo-3,5-dimethylheptane-2,6-dione
3,5-dibromo-3,5-dimethylheptane-2,6-dione (PubChem CID 22733671) has the molecular formula C9H14Br2O2
and a molecular weight of 314.02 g/mol. Its IUPAC name is 3,5-dibromo-3,5-dimethylheptane-2,6-dione.
Molecular Properties
| Compound Name | 3,5-dibromo-3,5-dimethylheptane-2,6-dione |
| PubChem CID | 22733671 |
| Molecular Formula | C9H14Br2O2 |
| Molecular Weight | 314.02 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | 3,5-dibromo-3,5-dimethylheptane-2,6-dione |
| SMILES | CC(=O)C(C)(Br)CC(C)(Br)C(C)=O |
| InChI | InChI=1S/C9H14Br2O2/c1-6(12)8(3,10)5-9(4,11)7(2)13/h5H2,1-4H3 |
| InChIKey | XJHBWFLNLIBIIZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.02 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-3,5-dimethylheptane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-3,5-dimethylheptane-2,6-dione?
The IUPAC name of 3,5-dibromo-3,5-dimethylheptane-2,6-dione (CID 22733671) is 3,5-dibromo-3,5-dimethylheptane-2,6-dione.
What is the SMILES notation for 3,5-dibromo-3,5-dimethylheptane-2,6-dione?
The canonical SMILES for 3,5-dibromo-3,5-dimethylheptane-2,6-dione is CC(=O)C(C)(Br)CC(C)(Br)C(C)=O.
What is the InChIKey of 3,5-dibromo-3,5-dimethylheptane-2,6-dione?
The InChIKey is XJHBWFLNLIBIIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14Br2O2/c1-6(12)8(3,10)5-9(4,11)7(2)13/h5H2,1-4H3.
What are the key properties of 3,5-dibromo-3,5-dimethylheptane-2,6-dione?
3,5-dibromo-3,5-dimethylheptane-2,6-dione has a molecular weight of 314.02 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-3,5-dimethylheptane-2,6-dione is sourced from PubChem (CID 22733671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).