About 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine
2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine (PubChem CID 22733832) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine |
| PubChem CID | 22733832 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine |
| SMILES | CC1=CCCC(N2C(C)CCC2C)=C1 |
| InChI | InChI=1S/C13H21N/c1-10-5-4-6-13(9-10)14-11(2)7-8-12(14)3/h5,9,11-12H,4,6-8H2,1-3H3 |
| InChIKey | JRJRSCAXDNKDGI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The IUPAC name of 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine (CID 22733832) is 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine.
What is the SMILES notation for 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The canonical SMILES for 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine is CC1=CCCC(N2C(C)CCC2C)=C1.
What is the InChIKey of 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The InChIKey is JRJRSCAXDNKDGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-10-5-4-6-13(9-10)14-11(2)7-8-12(14)3/h5,9,11-12H,4,6-8H2,1-3H3.
What are the key properties of 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine?
2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine has a molecular weight of 191.32 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-(3-methylcyclohexa-1,3-dien-1-yl)pyrrolidine is sourced from PubChem (CID 22733832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).