C16H15Cl2NO4 — CID 22734050
2-(3,5-dichloro-4-pyridinyl)-1-(2,3,4-trimethoxyphenyl)ethanone (PubChem CID 22734050) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-pyridinyl)-1-(2,3,4-trimethoxyphenyl)ethanone.
| Compound Name | 2-(3,5-dichloro-4-pyridinyl)-1-(2,3,4-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 22734050 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-(3,5-dichloro-4-pyridinyl)-1-(2,3,4-trimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2c(Cl)cncc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C16H15Cl2NO4/c1-21-14-5-4-9(15(22-2)16(14)23-3)13(20)6-10-11(17)7-19-8-12(10)18/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | MYTIOYQNHMMTNB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |