C27H28N2O3 — CID 22734211
7-methoxy-N-(2-phenylethyl)-4-[(2-phenylethylamino)methyl]-1-benzofuran-2-carboxamide (PubChem CID 22734211) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 7-methoxy-N-(2-phenylethyl)-4-[(2-phenylethylamino)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-(2-phenylethyl)-4-[(2-phenylethylamino)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 22734211 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 7-methoxy-N-(2-phenylethyl)-4-[(2-phenylethylamino)methyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(CNCCc2ccccc2)c2cc(C(=O)NCCc3ccccc3)oc12 |
| InChI | InChI=1S/C27H28N2O3/c1-31-24-13-12-22(19-28-16-14-20-8-4-2-5-9-20)23-18-25(32-26(23)24)27(30)29-17-15-21-10-6-3-7-11-21/h2-13,18,28H,14-17,19H2,1H3,(H,29,30) |
| InChIKey | NBTOXPJAIRINPJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|