About tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane
tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane (PubChem CID 22734375) has the molecular formula C21H36O3Sn
and a molecular weight of 455.23 g/mol. Its IUPAC name is tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane |
| PubChem CID | 22734375 |
| Molecular Formula | C21H36O3Sn |
| Molecular Weight | 455.23 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(OC)c2c1OCCO2 |
| InChI | InChI=1S/C9H9O3.3C4H9.Sn/c1-10-7-3-2-4-8-9(7)12-6-5-11-8;3*1-3-4-2;/h2-3H,5-6H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | TVEXEWMRVAZMNZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.23 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane?
The IUPAC name of tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane (CID 22734375) is tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane.
What is the SMILES notation for tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane?
The canonical SMILES for tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1ccc(OC)c2c1OCCO2.
What is the InChIKey of tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane?
The InChIKey is TVEXEWMRVAZMNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O3.3C4H9.Sn/c1-10-7-3-2-4-8-9(7)12-6-5-11-8;3*1-3-4-2;/h2-3H,5-6H2,1H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane?
tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane has a molecular weight of 455.23 g/mol, XLogP of 5.52, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(8-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)stannane is sourced from PubChem (CID 22734375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).