C16H12F7NO — CID 22734590
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-5-phenylaniline (PubChem CID 22734590) has the molecular formula C16H12F7NO and a molecular weight of 367.26 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-5-phenylaniline.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-5-phenylaniline |
|---|---|
| PubChem CID | 22734590 |
| Molecular Formula | C16H12F7NO |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-5-phenylaniline |
| SMILES | COc1cc(C(F)(C(F)(F)F)C(F)(F)F)c(-c2ccccc2)cc1N |
| InChI | InChI=1S/C16H12F7NO/c1-25-13-8-11(14(17,15(18,19)20)16(21,22)23)10(7-12(13)24)9-5-3-2-4-6-9/h2-8H,24H2,1H3 |
| InChIKey | NNDJCLWKGHPPMB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|