C17H23F7NO+ — CID 2273479
(2R)-3,3,4,4,5,5,5-heptafluoro-1-[(2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]pentan-2-ol (PubChem CID 2273479) has the molecular formula C17H23F7NO+ and a molecular weight of 390.36 g/mol. Its IUPAC name is (2R)-3,3,4,4,5,5,5-heptafluoro-1-[(2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]pentan-2-ol.
| Compound Name | (2R)-3,3,4,4,5,5,5-heptafluoro-1-[(2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]pentan-2-ol |
|---|---|
| PubChem CID | 2273479 |
| Molecular Formula | C17H23F7NO+ |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2R)-3,3,4,4,5,5,5-heptafluoro-1-[(2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]pentan-2-ol |
| SMILES | C=CC[C@H]1CC(C)=C[C@H](CC=C)[NH+]1C[C@@H](O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H22F7NO/c1-4-6-12-8-11(3)9-13(7-5-2)25(12)10-14(26)15(18,19)16(20,21)17(22,23)24/h4-5,8,12-14,26H,1-2,6-7,9-10H2,3H3/p+1/t12-,13-,14+/m0/s1 |
| InChIKey | HEGHOPOVQNLTNF-MELADBBJSA-O |
| XLogP | 3.30 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|