About 2-heptan-3-yl-1,4-dimethylbenzimidazole
2-heptan-3-yl-1,4-dimethylbenzimidazole (PubChem CID 22734816) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-heptan-3-yl-1,4-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 2-heptan-3-yl-1,4-dimethylbenzimidazole |
| PubChem CID | 22734816 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-heptan-3-yl-1,4-dimethylbenzimidazole |
| SMILES | CCCCC(CC)c1nc2c(C)cccc2n1C |
| InChI | InChI=1S/C16H24N2/c1-5-7-10-13(6-2)16-17-15-12(3)9-8-11-14(15)18(16)4/h8-9,11,13H,5-7,10H2,1-4H3 |
| InChIKey | JDACISDRDUTNNW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-heptan-3-yl-1,4-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptan-3-yl-1,4-dimethylbenzimidazole?
The IUPAC name of 2-heptan-3-yl-1,4-dimethylbenzimidazole (CID 22734816) is 2-heptan-3-yl-1,4-dimethylbenzimidazole.
What is the SMILES notation for 2-heptan-3-yl-1,4-dimethylbenzimidazole?
The canonical SMILES for 2-heptan-3-yl-1,4-dimethylbenzimidazole is CCCCC(CC)c1nc2c(C)cccc2n1C.
What is the InChIKey of 2-heptan-3-yl-1,4-dimethylbenzimidazole?
The InChIKey is JDACISDRDUTNNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-5-7-10-13(6-2)16-17-15-12(3)9-8-11-14(15)18(16)4/h8-9,11,13H,5-7,10H2,1-4H3.
What are the key properties of 2-heptan-3-yl-1,4-dimethylbenzimidazole?
2-heptan-3-yl-1,4-dimethylbenzimidazole has a molecular weight of 244.38 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptan-3-yl-1,4-dimethylbenzimidazole is sourced from PubChem (CID 22734816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).