About [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone
[5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone (PubChem CID 22734822) has the molecular formula C25H24N2O
and a molecular weight of 368.48 g/mol. Its IUPAC name is [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone |
| PubChem CID | 22734822 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone |
| SMILES | Cc1cc2[nH]c(CCCc3ccccc3)nc2c(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C25H24N2O/c1-17-16-21-24(23(18(17)2)25(28)20-13-7-4-8-14-20)27-22(26-21)15-9-12-19-10-5-3-6-11-19/h3-8,10-11,13-14,16H,9,12,15H2,1-2H3,(H,26,27) |
| InChIKey | YIHJLGGFLLWPMR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone?
The IUPAC name of [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone (CID 22734822) is [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone.
What is the SMILES notation for [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone?
The canonical SMILES for [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone is Cc1cc2[nH]c(CCCc3ccccc3)nc2c(C(=O)c2ccccc2)c1C.
What is the InChIKey of [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone?
The InChIKey is YIHJLGGFLLWPMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O/c1-17-16-21-24(23(18(17)2)25(28)20-13-7-4-8-14-20)27-22(26-21)15-9-12-19-10-5-3-6-11-19/h3-8,10-11,13-14,16H,9,12,15H2,1-2H3,(H,26,27).
What are the key properties of [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone?
[5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone has a molecular weight of 368.48 g/mol, XLogP of 5.59, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-dimethyl-2-(3-phenylpropyl)-1H-benzimidazol-4-yl]-phenylmethanone is sourced from PubChem (CID 22734822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).