C14H15F3N2O2S2 — CID 22735218
[2-(ethylsulfonylmethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-yl] thiocyanate (PubChem CID 22735218) has the molecular formula C14H15F3N2O2S2 and a molecular weight of 364.41 g/mol. Its IUPAC name is [2-(ethylsulfonylmethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-yl] thiocyanate.
| Compound Name | [2-(ethylsulfonylmethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-yl] thiocyanate |
|---|---|
| PubChem CID | 22735218 |
| Molecular Formula | C14H15F3N2O2S2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [2-(ethylsulfonylmethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-yl] thiocyanate |
| SMILES | CCS(=O)(=O)CC1CCc2cc(C(F)(F)F)cc(SC#N)c2N1 |
| InChI | InChI=1S/C14H15F3N2O2S2/c1-2-23(20,21)7-11-4-3-9-5-10(14(15,16)17)6-12(22-8-18)13(9)19-11/h5-6,11,19H,2-4,7H2,1H3 |
| InChIKey | OOGACRBGPOXRHX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|