About 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine
2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 22735321) has the molecular formula C10H10F3NS
and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 22735321 |
| Molecular Formula | C10H10F3NS |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CC1CNc2ccc(C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C10H10F3NS/c1-6-5-14-8-3-2-7(10(11,12)13)4-9(8)15-6/h2-4,6,14H,5H2,1H3 |
| InChIKey | NHFMEEQFAMOYQT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine (CID 22735321) is 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine is CC1CNc2ccc(C(F)(F)F)cc2S1.
What is the InChIKey of 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is NHFMEEQFAMOYQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NS/c1-6-5-14-8-3-2-7(10(11,12)13)4-9(8)15-6/h2-4,6,14H,5H2,1H3.
What are the key properties of 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine?
2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 233.26 g/mol, XLogP of 3.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 22735321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).