About 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate
2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate (PubChem CID 22735607) has the molecular formula C12H16O3S
and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate |
| PubChem CID | 22735607 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H16O3S/c1-16(13,14)15-7-6-10-8-11-4-2-3-5-12(11)9-10/h2-5,10H,6-9H2,1H3 |
| InChIKey | PVRRJSAZSKKAFB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate?
The IUPAC name of 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate (CID 22735607) is 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate.
What is the SMILES notation for 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate?
The canonical SMILES for 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate is CS(=O)(=O)OCCC1Cc2ccccc2C1.
What is the InChIKey of 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate?
The InChIKey is PVRRJSAZSKKAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S/c1-16(13,14)15-7-6-10-8-11-4-2-3-5-12(11)9-10/h2-5,10H,6-9H2,1H3.
What are the key properties of 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate?
2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate has a molecular weight of 240.32 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1H-inden-2-yl)ethyl methanesulfonate is sourced from PubChem (CID 22735607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).