C20H20Cl2N2S — CID 22735637
3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 22735637) has the molecular formula C20H20Cl2N2S and a molecular weight of 391.37 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | 3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 22735637 |
| Molecular Formula | C20H20Cl2N2S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | Clc1ccc(-c2cc3c4c(c2)C2CNCCC2N4CCCS3)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N2S/c21-13-2-3-14(17(22)10-13)12-8-15-16-11-23-5-4-18(16)24-6-1-7-25-19(9-12)20(15)24/h2-3,8-10,16,18,23H,1,4-7,11H2 |
| InChIKey | IAPOBLNNCBXVFF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |