About 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride
3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride (PubChem CID 22735703) has the molecular formula C9H13ClN2S
and a molecular weight of 216.74 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride |
| PubChem CID | 22735703 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride |
| SMILES | Cl.NN1CCCSc2ccccc21 |
| InChI | InChI=1S/C9H12N2S.ClH/c10-11-6-3-7-12-9-5-2-1-4-8(9)11;/h1-2,4-5H,3,6-7,10H2;1H |
| InChIKey | RPYSVTSDAOLBON-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride?
The IUPAC name of 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride (CID 22735703) is 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride.
What is the SMILES notation for 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride?
The canonical SMILES for 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride is Cl.NN1CCCSc2ccccc21.
What is the InChIKey of 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride?
The InChIKey is RPYSVTSDAOLBON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S.ClH/c10-11-6-3-7-12-9-5-2-1-4-8(9)11;/h1-2,4-5H,3,6-7,10H2;1H.
What are the key properties of 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride?
3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride has a molecular weight of 216.74 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,5-benzothiazepin-5-amine;hydrochloride is sourced from PubChem (CID 22735703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).