C14H16N2O — CID 22735883
6-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11(16)-tetraene (PubChem CID 22735883) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 6-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11(16)-tetraene.
| Compound Name | 6-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11(16)-tetraene |
|---|---|
| PubChem CID | 22735883 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 6-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11(16)-tetraene |
| SMILES | c1cc2c3c(c1)c1c(n3CCCO2)CCNC1 |
| InChI | InChI=1S/C14H16N2O/c1-3-10-11-9-15-6-5-12(11)16-7-2-8-17-13(4-1)14(10)16/h1,3-4,15H,2,5-9H2 |
| InChIKey | ZNWAXISMXVPADQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|