About 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride
7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride (PubChem CID 22736352) has the molecular formula C6H8Cl2N4
and a molecular weight of 207.06 g/mol. Its IUPAC name is 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride |
| PubChem CID | 22736352 |
| Molecular Formula | C6H8Cl2N4 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C6H6N4.2ClH/c7-5-4-1-2-8-6(4)10-3-9-5;;/h1-3H,(H3,7,8,9,10);2*1H |
| InChIKey | JTLMAHWVRSTRNJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride?
The IUPAC name of 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride (CID 22736352) is 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride.
What is the SMILES notation for 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride?
The canonical SMILES for 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride is Cl.Cl.Nc1ncnc2[nH]ccc12.
What is the InChIKey of 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride?
The InChIKey is JTLMAHWVRSTRNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.2ClH/c7-5-4-1-2-8-6(4)10-3-9-5;;/h1-3H,(H3,7,8,9,10);2*1H.
What are the key properties of 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride?
7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride has a molecular weight of 207.06 g/mol, XLogP of 1.38, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride is sourced from PubChem (CID 22736352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).