About N'-prop-2-enyloxamide
N'-prop-2-enyloxamide (PubChem CID 22736542) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is N'-prop-2-enyloxamide.
Molecular Properties
| Compound Name | N'-prop-2-enyloxamide |
| PubChem CID | 22736542 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(N)=O |
| InChI | InChI=1S/C5H8N2O2/c1-2-3-7-5(9)4(6)8/h2H,1,3H2,(H2,6,8)(H,7,9) |
| InChIKey | KGJYECREUMFWFM-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-prop-2-enyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-prop-2-enyloxamide?
The IUPAC name of N'-prop-2-enyloxamide (CID 22736542) is N'-prop-2-enyloxamide.
What is the SMILES notation for N'-prop-2-enyloxamide?
The canonical SMILES for N'-prop-2-enyloxamide is C=CCNC(=O)C(N)=O.
What is the InChIKey of N'-prop-2-enyloxamide?
The InChIKey is KGJYECREUMFWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-2-3-7-5(9)4(6)8/h2H,1,3H2,(H2,6,8)(H,7,9).
What are the key properties of N'-prop-2-enyloxamide?
N'-prop-2-enyloxamide has a molecular weight of 128.13 g/mol, XLogP of -1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-prop-2-enyloxamide is sourced from PubChem (CID 22736542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).