About 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine
4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine (PubChem CID 22736978) has the molecular formula C9H11N3OS
and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine.
Molecular Properties
| Compound Name | 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine |
| PubChem CID | 22736978 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine |
| SMILES | CNc1ccc(OC)c2nc(N)sc12 |
| InChI | InChI=1S/C9H11N3OS/c1-11-5-3-4-6(13-2)7-8(5)14-9(10)12-7/h3-4,11H,1-2H3,(H2,10,12) |
| InChIKey | AIEHQDODVPXCMT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine?
The IUPAC name of 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine (CID 22736978) is 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine.
What is the SMILES notation for 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine?
The canonical SMILES for 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine is CNc1ccc(OC)c2nc(N)sc12.
What is the InChIKey of 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine?
The InChIKey is AIEHQDODVPXCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS/c1-11-5-3-4-6(13-2)7-8(5)14-9(10)12-7/h3-4,11H,1-2H3,(H2,10,12).
What are the key properties of 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine?
4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine has a molecular weight of 209.27 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-7-N-methyl-1,3-benzothiazole-2,7-diamine is sourced from PubChem (CID 22736978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).