C25H42N2O6 — CID 22737303
4-[6-[3-[5,5-dimethyl-6-(3-oxo-1,2-oxazol-4-yl)hexoxy]propoxy]-2,2-dimethylhexyl]-1,2-oxazol-3-one (PubChem CID 22737303) has the molecular formula C25H42N2O6 and a molecular weight of 466.62 g/mol. Its IUPAC name is 4-[6-[3-[5,5-dimethyl-6-(3-oxo-1,2-oxazol-4-yl)hexoxy]propoxy]-2,2-dimethylhexyl]-1,2-oxazol-3-one.
| Compound Name | 4-[6-[3-[5,5-dimethyl-6-(3-oxo-1,2-oxazol-4-yl)hexoxy]propoxy]-2,2-dimethylhexyl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 22737303 |
| Molecular Formula | C25H42N2O6 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | 4-[6-[3-[5,5-dimethyl-6-(3-oxo-1,2-oxazol-4-yl)hexoxy]propoxy]-2,2-dimethylhexyl]-1,2-oxazol-3-one |
| SMILES | CC(C)(CCCCOCCCOCCCCC(C)(C)Cc1co[nH]c1=O)Cc1co[nH]c1=O |
| InChI | InChI=1S/C25H42N2O6/c1-24(2,16-20-18-32-26-22(20)28)10-5-7-12-30-14-9-15-31-13-8-6-11-25(3,4)17-21-19-33-27-23(21)29/h18-19H,5-17H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | KAVANKYBHONTGL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|