About 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol
6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol (PubChem CID 22737348) has the molecular formula C19H40O4
and a molecular weight of 332.53 g/mol. Its IUPAC name is 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol.
Molecular Properties
| Compound Name | 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol |
| PubChem CID | 22737348 |
| Molecular Formula | C19H40O4 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol |
| SMILES | CC(C)(CCO)CCCOCCCOCCCC(C)(C)CCO |
| InChI | InChI=1S/C19H40O4/c1-18(2,10-12-20)8-5-14-22-16-7-17-23-15-6-9-19(3,4)11-13-21/h20-21H,5-17H2,1-4H3 |
| InChIKey | SQHZVZHSPNKTCL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol?
The IUPAC name of 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol (CID 22737348) is 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol.
What is the SMILES notation for 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol?
The canonical SMILES for 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol is CC(C)(CCO)CCCOCCCOCCCC(C)(C)CCO.
What is the InChIKey of 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol?
The InChIKey is SQHZVZHSPNKTCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O4/c1-18(2,10-12-20)8-5-14-22-16-7-17-23-15-6-9-19(3,4)11-13-21/h20-21H,5-17H2,1-4H3.
What are the key properties of 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol?
6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol has a molecular weight of 332.53 g/mol, XLogP of 3.79, 16 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(6-hydroxy-4,4-dimethylhexoxy)propoxy]-3,3-dimethylhexan-1-ol is sourced from PubChem (CID 22737348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).