About 2-propyl-4-(2,2,2-trifluoroethoxy)phenol
2-propyl-4-(2,2,2-trifluoroethoxy)phenol (PubChem CID 22737353) has the molecular formula C11H13F3O2
and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-propyl-4-(2,2,2-trifluoroethoxy)phenol.
Molecular Properties
| Compound Name | 2-propyl-4-(2,2,2-trifluoroethoxy)phenol |
| PubChem CID | 22737353 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-propyl-4-(2,2,2-trifluoroethoxy)phenol |
| SMILES | CCCc1cc(OCC(F)(F)F)ccc1O |
| InChI | InChI=1S/C11H13F3O2/c1-2-3-8-6-9(4-5-10(8)15)16-7-11(12,13)14/h4-6,15H,2-3,7H2,1H3 |
| InChIKey | DQNPGBWGIGDEEC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propyl-4-(2,2,2-trifluoroethoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-4-(2,2,2-trifluoroethoxy)phenol?
The IUPAC name of 2-propyl-4-(2,2,2-trifluoroethoxy)phenol (CID 22737353) is 2-propyl-4-(2,2,2-trifluoroethoxy)phenol.
What is the SMILES notation for 2-propyl-4-(2,2,2-trifluoroethoxy)phenol?
The canonical SMILES for 2-propyl-4-(2,2,2-trifluoroethoxy)phenol is CCCc1cc(OCC(F)(F)F)ccc1O.
What is the InChIKey of 2-propyl-4-(2,2,2-trifluoroethoxy)phenol?
The InChIKey is DQNPGBWGIGDEEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3O2/c1-2-3-8-6-9(4-5-10(8)15)16-7-11(12,13)14/h4-6,15H,2-3,7H2,1H3.
What are the key properties of 2-propyl-4-(2,2,2-trifluoroethoxy)phenol?
2-propyl-4-(2,2,2-trifluoroethoxy)phenol has a molecular weight of 234.22 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-4-(2,2,2-trifluoroethoxy)phenol is sourced from PubChem (CID 22737353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).