C32H58B4O8 — CID 22737474
4,4,5,5-tetramethyl-2-[(1E,7E)-1,7,8-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane (PubChem CID 22737474) has the molecular formula C32H58B4O8 and a molecular weight of 614.06 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1E,7E)-1,7,8-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1E,7E)-1,7,8-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 22737474 |
| Molecular Formula | C32H58B4O8 |
| Molecular Weight | 614.06 g/mol |
| Exact Mass | 614.45 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1E,7E)-1,7,8-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,7-dien-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C=C(/CCCC/C(=C/B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C32H58B4O8/c1-25(2)26(3,4)38-33(37-25)21-23(35-41-29(9,10)30(11,12)42-35)19-17-18-20-24(36-43-31(13,14)32(15,16)44-36)22-34-39-27(5,6)28(7,8)40-34/h21-22H,17-20H2,1-16H3/b23-21-,24-22- |
| InChIKey | XLGQLEYSNFOTMH-SXAUZNKPSA-N |
| XLogP | 6.93 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.06 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|