C23H28O2 — CID 22737551
2-[[4-[3,5-dimethyl-4-(oxiran-2-ylmethyl)phenyl]-2,3,6-trimethylphenyl]methyl]oxirane (PubChem CID 22737551) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-[[4-[3,5-dimethyl-4-(oxiran-2-ylmethyl)phenyl]-2,3,6-trimethylphenyl]methyl]oxirane.
| Compound Name | 2-[[4-[3,5-dimethyl-4-(oxiran-2-ylmethyl)phenyl]-2,3,6-trimethylphenyl]methyl]oxirane |
|---|---|
| PubChem CID | 22737551 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-[[4-[3,5-dimethyl-4-(oxiran-2-ylmethyl)phenyl]-2,3,6-trimethylphenyl]methyl]oxirane |
| SMILES | Cc1cc(-c2cc(C)c(CC3CO3)c(C)c2C)cc(C)c1CC1CO1 |
| InChI | InChI=1S/C23H28O2/c1-13-6-18(7-14(2)21(13)9-19-11-24-19)23-8-15(3)22(10-20-12-25-20)16(4)17(23)5/h6-8,19-20H,9-12H2,1-5H3 |
| InChIKey | OTGFOFZHYCVTFR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|