C24H21F3N2O2 — CID 22739662
5-hydroxy-7-propan-2-yl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide (PubChem CID 22739662) has the molecular formula C24H21F3N2O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 5-hydroxy-7-propan-2-yl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide.
| Compound Name | 5-hydroxy-7-propan-2-yl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 22739662 |
| Molecular Formula | C24H21F3N2O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-hydroxy-7-propan-2-yl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
| SMILES | CC(C)c1cc(O)c2c3c(C(N)=O)cccc3n(Cc3ccccc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C24H21F3N2O2/c1-13(2)15-10-19-22(20(30)11-15)21-16(23(28)31)7-5-9-18(21)29(19)12-14-6-3-4-8-17(14)24(25,26)27/h3-11,13,30H,12H2,1-2H3,(H2,28,31) |
| InChIKey | LIPLNRGDWNFOIL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |