C25H25FN2O2 — CID 22740755
9-[(2-fluorophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxamide (PubChem CID 22740755) has the molecular formula C25H25FN2O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 9-[(2-fluorophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxamide.
| Compound Name | 9-[(2-fluorophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 22740755 |
| Molecular Formula | C25H25FN2O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 9-[(2-fluorophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxamide |
| SMILES | CCCCCc1cc(O)c2c3c(C(N)=O)cccc3n(Cc3ccccc3F)c2c1 |
| InChI | InChI=1S/C25H25FN2O2/c1-2-3-4-8-16-13-21-24(22(29)14-16)23-18(25(27)30)10-7-12-20(23)28(21)15-17-9-5-6-11-19(17)26/h5-7,9-14,29H,2-4,8,15H2,1H3,(H2,27,30) |
| InChIKey | JAGDDNRTKVXIIR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|