About N-octylsulfonylacetamide
N-octylsulfonylacetamide (PubChem CID 22741475) has the molecular formula C10H21NO3S
and a molecular weight of 235.35 g/mol. Its IUPAC name is N-octylsulfonylacetamide.
Molecular Properties
| Compound Name | N-octylsulfonylacetamide |
| PubChem CID | 22741475 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-octylsulfonylacetamide |
| SMILES | CCCCCCCCS(=O)(=O)NC(C)=O |
| InChI | InChI=1S/C10H21NO3S/c1-3-4-5-6-7-8-9-15(13,14)11-10(2)12/h3-9H2,1-2H3,(H,11,12) |
| InChIKey | NMHMMWXLFBFPJM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-octylsulfonylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octylsulfonylacetamide?
The IUPAC name of N-octylsulfonylacetamide (CID 22741475) is N-octylsulfonylacetamide.
What is the SMILES notation for N-octylsulfonylacetamide?
The canonical SMILES for N-octylsulfonylacetamide is CCCCCCCCS(=O)(=O)NC(C)=O.
What is the InChIKey of N-octylsulfonylacetamide?
The InChIKey is NMHMMWXLFBFPJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3S/c1-3-4-5-6-7-8-9-15(13,14)11-10(2)12/h3-9H2,1-2H3,(H,11,12).
What are the key properties of N-octylsulfonylacetamide?
N-octylsulfonylacetamide has a molecular weight of 235.35 g/mol, XLogP of 1.81, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-octylsulfonylacetamide is sourced from PubChem (CID 22741475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).