About N,N-diaminoaniline
N,N-diaminoaniline (PubChem CID 22741643) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is N,N-diaminoaniline.
Molecular Properties
| Compound Name | N,N-diaminoaniline |
| PubChem CID | 22741643 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | N,N-diaminoaniline |
| SMILES | NN(N)c1ccccc1 |
| InChI | InChI=1S/C6H9N3/c7-9(8)6-4-2-1-3-5-6/h1-5H,7-8H2 |
| InChIKey | AXKVOSSFZLZIDC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diaminoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diaminoaniline?
The IUPAC name of N,N-diaminoaniline (CID 22741643) is N,N-diaminoaniline.
What is the SMILES notation for N,N-diaminoaniline?
The canonical SMILES for N,N-diaminoaniline is NN(N)c1ccccc1.
What is the InChIKey of N,N-diaminoaniline?
The InChIKey is AXKVOSSFZLZIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c7-9(8)6-4-2-1-3-5-6/h1-5H,7-8H2.
What are the key properties of N,N-diaminoaniline?
N,N-diaminoaniline has a molecular weight of 123.16 g/mol, XLogP of 0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diaminoaniline is sourced from PubChem (CID 22741643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).