About [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone
[3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone (PubChem CID 22741745) has the molecular formula C27H33Cl2NO3
and a molecular weight of 490.47 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone |
| PubChem CID | 22741745 |
| Molecular Formula | C27H33Cl2NO3 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCCCC(CCCOC2CCCCO2)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C27H33Cl2NO3/c28-23-13-12-22(19-24(23)29)27(15-8-18-33-25-11-4-7-17-32-25)14-5-6-16-30(20-27)26(31)21-9-2-1-3-10-21/h1-3,9-10,12-13,19,25H,4-8,11,14-18,20H2 |
| InChIKey | FTLHGZYIDYAGRM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone?
The IUPAC name of [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone (CID 22741745) is [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone.
What is the SMILES notation for [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone?
The canonical SMILES for [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone is O=C(c1ccccc1)N1CCCCC(CCCOC2CCCCO2)(c2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone?
The InChIKey is FTLHGZYIDYAGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33Cl2NO3/c28-23-13-12-22(19-24(23)29)27(15-8-18-33-25-11-4-7-17-32-25)14-5-6-16-30(20-27)26(31)21-9-2-1-3-10-21/h1-3,9-10,12-13,19,25H,4-8,11,14-18,20H2.
What are the key properties of [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone?
[3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone has a molecular weight of 490.47 g/mol, XLogP of 6.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dichlorophenyl)-3-[3-(oxan-2-yloxy)propyl]azepan-1-yl]-phenylmethanone is sourced from PubChem (CID 22741745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).