C17H23N3O3 — CID 2274195
5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 2274195) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2274195 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)c1ccc(CC2C(=O)N(C)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-5-20(6-2)13-9-7-12(8-10-13)11-14-15(21)18(3)17(23)19(4)16(14)22/h7-10,14H,5-6,11H2,1-4H3 |
| InChIKey | VBNCQXWZJXPJHC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|