C20H24N2O3S — CID 2274224
3-[4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 2274224) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-[4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 2274224 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]pyridin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CN(C)c1ccc(/C=C/C=C/c2cc[n+](CCCS(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-21(2)20-10-8-18(9-11-20)6-3-4-7-19-12-15-22(16-13-19)14-5-17-26(23,24)25/h3-4,6-13,15-16H,5,14,17H2,1-2H3 |
| InChIKey | QEENOGDGAIEBEG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|