About 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine
5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine (PubChem CID 22742303) has the molecular formula C21H23BrN2O
and a molecular weight of 399.33 g/mol. Its IUPAC name is 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine |
| PubChem CID | 22742303 |
| Molecular Formula | C21H23BrN2O |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine |
| SMILES | CC(C)Oc1ccc(Br)cc1/C=C/C1=NCCN(C)c2ccccc21 |
| InChI | InChI=1S/C21H23BrN2O/c1-15(2)25-21-11-9-17(22)14-16(21)8-10-19-18-6-4-5-7-20(18)24(3)13-12-23-19/h4-11,14-15H,12-13H2,1-3H3/b10-8+ |
| InChIKey | HFVBNRYEIMZYLG-CSKARUKUSA-N |
| XLogP | 5.19 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine?
The IUPAC name of 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine (CID 22742303) is 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine.
What is the SMILES notation for 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine?
The canonical SMILES for 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine is CC(C)Oc1ccc(Br)cc1/C=C/C1=NCCN(C)c2ccccc21.
What is the InChIKey of 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine?
The InChIKey is HFVBNRYEIMZYLG-CSKARUKUSA-N. The full InChI is InChI=1S/C21H23BrN2O/c1-15(2)25-21-11-9-17(22)14-16(21)8-10-19-18-6-4-5-7-20(18)24(3)13-12-23-19/h4-11,14-15H,12-13H2,1-3H3/b10-8+.
What are the key properties of 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine?
5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine has a molecular weight of 399.33 g/mol, XLogP of 5.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(5-bromo-2-propan-2-yloxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine is sourced from PubChem (CID 22742303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).