About tricyclo[4.3.0.03,9]nona-1(6),2,4-triene
tricyclo[4.3.0.03,9]nona-1(6),2,4-triene (PubChem CID 22742804) has the molecular formula C9H8
and a molecular weight of 116.16 g/mol. Its IUPAC name is tricyclo[4.3.0.03,9]nona-1(6),2,4-triene.
Molecular Properties
| Compound Name | tricyclo[4.3.0.03,9]nona-1(6),2,4-triene |
| PubChem CID | 22742804 |
| Molecular Formula | C9H8 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | tricyclo[4.3.0.03,9]nona-1(6),2,4-triene |
| SMILES | C1=CC2=C3C=C1C3CC2 |
| InChI | InChI=1S/C9H8/c1-2-7-5-9-6(1)3-4-8(7)9/h1-2,5,8H,3-4H2 |
| InChIKey | VXSHJAJNISCUEZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclo[4.3.0.03,9]nona-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[4.3.0.03,9]nona-1(6),2,4-triene?
The IUPAC name of tricyclo[4.3.0.03,9]nona-1(6),2,4-triene (CID 22742804) is tricyclo[4.3.0.03,9]nona-1(6),2,4-triene.
What is the SMILES notation for tricyclo[4.3.0.03,9]nona-1(6),2,4-triene?
The canonical SMILES for tricyclo[4.3.0.03,9]nona-1(6),2,4-triene is C1=CC2=C3C=C1C3CC2.
What is the InChIKey of tricyclo[4.3.0.03,9]nona-1(6),2,4-triene?
The InChIKey is VXSHJAJNISCUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8/c1-2-7-5-9-6(1)3-4-8(7)9/h1-2,5,8H,3-4H2.
What are the key properties of tricyclo[4.3.0.03,9]nona-1(6),2,4-triene?
tricyclo[4.3.0.03,9]nona-1(6),2,4-triene has a molecular weight of 116.16 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[4.3.0.03,9]nona-1(6),2,4-triene is sourced from PubChem (CID 22742804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).