C33H40N2O5 — CID 22742819
2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 22742819) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 22742819 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | COc1ccc(CC2c3cc(OC)c(OC)cc3CCN2CC(=O)NC2c3ccccc3CCC2C)cc1OC |
| InChI | InChI=1S/C33H40N2O5/c1-21-10-12-23-8-6-7-9-25(23)33(21)34-32(36)20-35-15-14-24-18-30(39-4)31(40-5)19-26(24)27(35)16-22-11-13-28(37-2)29(17-22)38-3/h6-9,11,13,17-19,21,27,33H,10,12,14-16,20H2,1-5H3,(H,34,36) |
| InChIKey | CGJUYBOMSUNTIS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |