C16H30O4S — CID 22743163
6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid (PubChem CID 22743163) has the molecular formula C16H30O4S and a molecular weight of 318.48 g/mol. Its IUPAC name is 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid.
| Compound Name | 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid |
|---|---|
| PubChem CID | 22743163 |
| Molecular Formula | C16H30O4S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid |
| SMILES | CC(C)(CCCSCCCC(C)(C)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H30O4S/c1-15(2,11-13(17)18)7-5-9-21-10-6-8-16(3,4)12-14(19)20/h5-12H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | MGIWVIZJXFNCMM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|