About 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid
6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid (PubChem CID 22743163) has the molecular formula C16H30O4S
and a molecular weight of 318.48 g/mol. Its IUPAC name is 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid |
| PubChem CID | 22743163 |
| Molecular Formula | C16H30O4S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid |
| SMILES | CC(C)(CCCSCCCC(C)(C)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H30O4S/c1-15(2,11-13(17)18)7-5-9-21-10-6-8-16(3,4)12-14(19)20/h5-12H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | MGIWVIZJXFNCMM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid?
The IUPAC name of 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid (CID 22743163) is 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid.
What is the SMILES notation for 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid?
The canonical SMILES for 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid is CC(C)(CCCSCCCC(C)(C)CC(=O)O)CC(=O)O.
What is the InChIKey of 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid?
The InChIKey is MGIWVIZJXFNCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O4S/c1-15(2,11-13(17)18)7-5-9-21-10-6-8-16(3,4)12-14(19)20/h5-12H2,1-4H3,(H,17,18)(H,19,20).
What are the key properties of 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid?
6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid has a molecular weight of 318.48 g/mol, XLogP of 4.28, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-carboxy-4,4-dimethylpentyl)sulfanyl-3,3-dimethylhexanoic acid is sourced from PubChem (CID 22743163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).