About (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite
(2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite (PubChem CID 22743473) has the molecular formula C14H7FO4
and a molecular weight of 258.20 g/mol. Its IUPAC name is (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite.
Molecular Properties
| Compound Name | (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite |
| PubChem CID | 22743473 |
| Molecular Formula | C14H7FO4 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(O)c2OF |
| InChI | InChI=1S/C14H7FO4/c15-19-14-10(16)6-5-9-11(14)13(18)8-4-2-1-3-7(8)12(9)17/h1-6,16H |
| InChIKey | OOUZLFYNNMZISR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite?
The IUPAC name of (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite (CID 22743473) is (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite.
What is the SMILES notation for (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite?
The canonical SMILES for (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite is O=C1c2ccccc2C(=O)c2c1ccc(O)c2OF.
What is the InChIKey of (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite?
The InChIKey is OOUZLFYNNMZISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7FO4/c15-19-14-10(16)6-5-9-11(14)13(18)8-4-2-1-3-7(8)12(9)17/h1-6,16H.
What are the key properties of (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite?
(2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite has a molecular weight of 258.20 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-9,10-dioxoanthracen-1-yl) hypofluorite is sourced from PubChem (CID 22743473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).